C23H38O3 — CID 59804836
(2R,4R,6R,7R,9R,14R)-6-hydroxy-9-methoxy-2,4,7,14-tetramethyl-4-(2-methylprop-2-enyl)tricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 59804836) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (2R,4R,6R,7R,9R,14R)-6-hydroxy-9-methoxy-2,4,7,14-tetramethyl-4-(2-methylprop-2-enyl)tricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4R,6R,7R,9R,14R)-6-hydroxy-9-methoxy-2,4,7,14-tetramethyl-4-(2-methylprop-2-enyl)tricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 59804836 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (2R,4R,6R,7R,9R,14R)-6-hydroxy-9-methoxy-2,4,7,14-tetramethyl-4-(2-methylprop-2-enyl)tricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | C=C(C)C[C@]1(C)C[C@@H](O)[C@@]2(C)C3C(OC)CCC3(CC[C@H]2C)[C@@H](C)C1=O |
| InChI | InChI=1S/C23H38O3/c1-14(2)12-21(5)13-18(24)22(6)15(3)8-10-23(16(4)20(21)25)11-9-17(26-7)19(22)23/h15-19,24H,1,8-13H2,2-7H3/t15-,16+,17?,18-,19?,21-,22+,23?/m1/s1 |
| InChIKey | OQUVJSXPGSBMMN-QOVFQUITSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|