C23H37F3O4 — CID 59804852
(2R,4S,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-4-(2,2,2-trifluoroethyl)tricyclo[5.4.3.01,8]tetradecan-3-one (PubChem CID 59804852) has the molecular formula C23H37F3O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (2R,4S,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-4-(2,2,2-trifluoroethyl)tricyclo[5.4.3.01,8]tetradecan-3-one.
| Compound Name | (2R,4S,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-4-(2,2,2-trifluoroethyl)tricyclo[5.4.3.01,8]tetradecan-3-one |
|---|---|
| PubChem CID | 59804852 |
| Molecular Formula | C23H37F3O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | (2R,4S,7R,9R,14R)-9-methoxy-6-(methoxymethoxy)-2,4,7,14-tetramethyl-4-(2,2,2-trifluoroethyl)tricyclo[5.4.3.01,8]tetradecan-3-one |
| SMILES | COCOC1C[C@@](C)(CC(F)(F)F)C(=O)[C@H](C)C23CCC(OC)C2[C@@]1(C)[C@H](C)CC3 |
| InChI | InChI=1S/C23H37F3O4/c1-14-7-9-22-10-8-16(29-6)18(22)21(14,4)17(30-13-28-5)11-20(3,12-23(24,25)26)19(27)15(22)2/h14-18H,7-13H2,1-6H3/t14-,15+,16?,17?,18?,20+,21+,22?/m1/s1 |
| InChIKey | GVEWISZPWVNMNC-OQBSXEFKSA-N |
| XLogP | 5.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|