C8H4F6O4 — CID 59805379
3,4-bis(2,2,2-trifluoroethoxy)cyclobut-3-ene-1,2-dione (PubChem CID 59805379) has the molecular formula C8H4F6O4 and a molecular weight of 278.10 g/mol. Its IUPAC name is 3,4-bis(2,2,2-trifluoroethoxy)cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis(2,2,2-trifluoroethoxy)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 59805379 |
| Molecular Formula | C8H4F6O4 |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 3,4-bis(2,2,2-trifluoroethoxy)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(OCC(F)(F)F)c(OCC(F)(F)F)c1=O |
| InChI | InChI=1S/C8H4F6O4/c9-7(10,11)1-17-5-3(15)4(16)6(5)18-2-8(12,13)14/h1-2H2 |
| InChIKey | QKRLSKZUKBPWIV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|