C27H29ClN2O7S — CID 59805581
2-[[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 59805581) has the molecular formula C27H29ClN2O7S and a molecular weight of 561.06 g/mol. Its IUPAC name is 2-[[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 59805581 |
| Molecular Formula | C27H29ClN2O7S |
| Molecular Weight | 561.06 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 2-[[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]methyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | COc1cccc([C@H]2O[C@H](Cc3ncc(C(=O)O)s3)C(=O)N(CC(C)(C)CO)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C27H29ClN2O7S/c1-27(2,14-31)13-30-18-9-8-15(28)10-17(18)23(16-6-5-7-19(35-3)24(16)36-4)37-20(25(30)32)11-22-29-12-21(38-22)26(33)34/h5-10,12,20,23,31H,11,13-14H2,1-4H3,(H,33,34)/t20-,23-/m1/s1 |
| InChIKey | LRQRLYQEAQZIEP-NFBKMPQASA-N |
| XLogP | 4.59 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.06 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |