C32H39ClN2O7S — CID 59805644
4-[2-[3-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]propyl]-1,3-thiazol-5-yl]butanoic acid (PubChem CID 59805644) has the molecular formula C32H39ClN2O7S and a molecular weight of 631.19 g/mol. Its IUPAC name is 4-[2-[3-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]propyl]-1,3-thiazol-5-yl]butanoic acid.
| Compound Name | 4-[2-[3-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]propyl]-1,3-thiazol-5-yl]butanoic acid |
|---|---|
| PubChem CID | 59805644 |
| Molecular Formula | C32H39ClN2O7S |
| Molecular Weight | 631.19 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 4-[2-[3-[(3R,5S)-7-chloro-5-(2,3-dimethoxyphenyl)-1-(3-hydroxy-2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]propyl]-1,3-thiazol-5-yl]butanoic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CCCc3ncc(CCCC(=O)O)s3)C(=O)N(CC(C)(C)CO)c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C32H39ClN2O7S/c1-32(2,19-36)18-35-24-15-14-20(33)16-23(24)29(22-9-6-10-25(40-3)30(22)41-4)42-26(31(35)39)11-7-12-27-34-17-21(43-27)8-5-13-28(37)38/h6,9-10,14-17,26,29,36H,5,7-8,11-13,18-19H2,1-4H3,(H,37,38)/t26-,29-/m1/s1 |
| InChIKey | XAGOXJGXMYLQKC-GGXMVOPNSA-N |
| XLogP | 6.08 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.19 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |