C25H38O5 — CID 59806061
(3S,4S,6E,8S,12S)-8-(methoxymethoxy)-12-methyl-10-methylidene-13-[(2R,6R)-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]trideca-1,6-diene-3,4-diol (PubChem CID 59806061) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (3S,4S,6E,8S,12S)-8-(methoxymethoxy)-12-methyl-10-methylidene-13-[(2R,6R)-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]trideca-1,6-diene-3,4-diol.
| Compound Name | (3S,4S,6E,8S,12S)-8-(methoxymethoxy)-12-methyl-10-methylidene-13-[(2R,6R)-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]trideca-1,6-diene-3,4-diol |
|---|---|
| PubChem CID | 59806061 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (3S,4S,6E,8S,12S)-8-(methoxymethoxy)-12-methyl-10-methylidene-13-[(2R,6R)-6-prop-2-ynyl-3,6-dihydro-2H-pyran-2-yl]trideca-1,6-diene-3,4-diol |
| SMILES | C#CC[C@@H]1C=CC[C@@H](C[C@@H](C)CC(=C)C[C@@H](/C=C/C[C@H](O)[C@@H](O)C=C)OCOC)O1 |
| InChI | InChI=1S/C25H38O5/c1-6-10-21-11-8-13-23(30-21)17-20(4)15-19(3)16-22(29-18-28-5)12-9-14-25(27)24(26)7-2/h1,7-9,11-12,20-27H,2-3,10,13-18H2,4-5H3/b12-9+/t20-,21+,22+,23-,24-,25-/m0/s1 |
| InChIKey | IPVFQJZNHZFVBC-ZAWRRQJESA-N |
| XLogP | 3.93 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|