C17H32O3Si — CID 59806073
tert-butyl-[(Z)-4-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-dimethylsilane (PubChem CID 59806073) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is tert-butyl-[(Z)-4-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-4-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 59806073 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | tert-butyl-[(Z)-4-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@H]1/C=C\CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-9-14-15(20-17(5,6)19-14)12-10-11-13-18-21(7,8)16(2,3)4/h9-10,12,14-15H,1,11,13H2,2-8H3/b12-10-/t14-,15-/m0/s1 |
| InChIKey | KEGGKCVELLAKER-OJBGHLBWSA-N |
| XLogP | 4.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|