C20H42O3Si2 — CID 59806077
(3Z,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]octa-3,7-dien-1-ol (PubChem CID 59806077) has the molecular formula C20H42O3Si2 and a molecular weight of 386.73 g/mol. Its IUPAC name is (3Z,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]octa-3,7-dien-1-ol.
| Compound Name | (3Z,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]octa-3,7-dien-1-ol |
|---|---|
| PubChem CID | 59806077 |
| Molecular Formula | C20H42O3Si2 |
| Molecular Weight | 386.73 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (3Z,5S,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]octa-3,7-dien-1-ol |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C\CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O3Si2/c1-12-17(22-24(8,9)19(2,3)4)18(15-13-14-16-21)23-25(10,11)20(5,6)7/h12-13,15,17-18,21H,1,14,16H2,2-11H3/b15-13-/t17-,18+/m1/s1 |
| InChIKey | HXXYIIZUAJZEKD-XRSVIKRQSA-N |
| XLogP | 5.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.73 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|