C20H32FNO5Si — CID 59806229
methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-3-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 59806229) has the molecular formula C20H32FNO5Si and a molecular weight of 413.56 g/mol. Its IUPAC name is methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-3-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-3-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 59806229 |
| Molecular Formula | C20H32FNO5Si |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | methyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-3-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)C[C@@H](NC(=O)OCc1ccccc1)[C@@H](CF)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32FNO5Si/c1-20(2,3)28(5,6)27-17(13-21)16(12-18(23)25-4)22-19(24)26-14-15-10-8-7-9-11-15/h7-11,16-17H,12-14H2,1-6H3,(H,22,24)/t16-,17-/m1/s1 |
| InChIKey | XVGIYFCKDIIYSP-IAGOWNOFSA-N |
| XLogP | 4.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|