C32H48O4 — CID 59806361
2,4-bis[(2,6-ditert-butylpyran-4-ylidene)methyl]cyclobutane-1,3-diol (PubChem CID 59806361) has the molecular formula C32H48O4 and a molecular weight of 496.73 g/mol. Its IUPAC name is 2,4-bis[(2,6-ditert-butylpyran-4-ylidene)methyl]cyclobutane-1,3-diol.
| Compound Name | 2,4-bis[(2,6-ditert-butylpyran-4-ylidene)methyl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 59806361 |
| Molecular Formula | C32H48O4 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | 2,4-bis[(2,6-ditert-butylpyran-4-ylidene)methyl]cyclobutane-1,3-diol |
| SMILES | CC(C)(C)C1=CC(=CC2C(O)C(C=C3C=C(C(C)(C)C)OC(C(C)(C)C)=C3)C2O)C=C(C(C)(C)C)O1 |
| InChI | InChI=1S/C32H48O4/c1-29(2,3)23-15-19(16-24(35-23)30(4,5)6)13-21-27(33)22(28(21)34)14-20-17-25(31(7,8)9)36-26(18-20)32(10,11)12/h13-18,21-22,27-28,33-34H,1-12H3 |
| InChIKey | BISMMHGNZYWKHV-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |