C30H51NO6Si — CID 59806430
5-O-benzyl 3-O-[2-(diethylamino)ethyl] 1-O-trimethylsilyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 59806430) has the molecular formula C30H51NO6Si and a molecular weight of 549.83 g/mol. Its IUPAC name is 5-O-benzyl 3-O-[2-(diethylamino)ethyl] 1-O-trimethylsilyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 5-O-benzyl 3-O-[2-(diethylamino)ethyl] 1-O-trimethylsilyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59806430 |
| Molecular Formula | C30H51NO6Si |
| Molecular Weight | 549.83 g/mol |
| Exact Mass | 549.35 |
| IUPAC Name | 5-O-benzyl 3-O-[2-(diethylamino)ethyl] 1-O-trimethylsilyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCN(CC)CCOC(=O)C(C)(CC(C)(C)C(=O)O[Si](C)(C)C)CC(C)(CC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H51NO6Si/c1-11-29(6,26(33)36-21-24-17-15-14-16-18-24)23-30(7,27(34)35-20-19-31(12-2)13-3)22-28(4,5)25(32)37-38(8,9)10/h14-18H,11-13,19-23H2,1-10H3 |
| InChIKey | GRRYONSMDGMEMY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.83 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|