About CID 59806673
CID 59806673 (PubChem CID 59806673) has the molecular formula C11H10IrN3+
and a molecular weight of 376.44 g/mol.
Molecular Properties
| Compound Name | CID 59806673 |
| PubChem CID | 59806673 |
| Molecular Formula | C11H10IrN3+ |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | — |
| SMILES | Cn1[cH+]n2cc3ccccc3cc2n1.[Ir] |
| InChI | InChI=1S/C11H10N3.Ir/c1-13-8-14-7-10-5-3-2-4-9(10)6-11(14)12-13;/h2-8H,1H3;/q+1; |
| InChIKey | UUWVTMNYFQPJCU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59806673 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59806673?
The IUPAC name of CID 59806673 (CID 59806673) is not available.
What is the SMILES notation for CID 59806673?
The canonical SMILES for CID 59806673 is Cn1[cH+]n2cc3ccccc3cc2n1.[Ir].
What is the InChIKey of CID 59806673?
The InChIKey is UUWVTMNYFQPJCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N3.Ir/c1-13-8-14-7-10-5-3-2-4-9(10)6-11(14)12-13;/h2-8H,1H3;/q+1;.
What are the key properties of CID 59806673?
CID 59806673 has a molecular weight of 376.44 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59806673 is sourced from PubChem (CID 59806673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).