C11H15N3S3 — CID 598068
imidazo[2,1-b][1,3]thiazol-6-ylmethyl N,N-diethylcarbamodithioate (PubChem CID 598068) has the molecular formula C11H15N3S3 and a molecular weight of 285.46 g/mol. Its IUPAC name is imidazo[2,1-b][1,3]thiazol-6-ylmethyl N,N-diethylcarbamodithioate.
| Compound Name | imidazo[2,1-b][1,3]thiazol-6-ylmethyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 598068 |
| Molecular Formula | C11H15N3S3 |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | imidazo[2,1-b][1,3]thiazol-6-ylmethyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1cn2ccsc2n1 |
| InChI | InChI=1S/C11H15N3S3/c1-3-13(4-2)11(15)17-8-9-7-14-5-6-16-10(14)12-9/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | YCVZLTSYGYXTIF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|