About methyl(2-methylpropyl)azanide;tungsten
methyl(2-methylpropyl)azanide;tungsten (PubChem CID 59806957) has the molecular formula C5H12NW-
and a molecular weight of 270.00 g/mol. Its IUPAC name is methyl(2-methylpropyl)azanide;tungsten.
Molecular Properties
| Compound Name | methyl(2-methylpropyl)azanide;tungsten |
| PubChem CID | 59806957 |
| Molecular Formula | C5H12NW- |
| Molecular Weight | 270.00 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | methyl(2-methylpropyl)azanide;tungsten |
| SMILES | C[N-]CC(C)C.[W] |
| InChI | InChI=1S/C5H12N.W/c1-5(2)4-6-3;/h5H,4H2,1-3H3;/q-1; |
| InChIKey | DFFSSKHFDGOGLV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.00 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methyl(2-methylpropyl)azanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(2-methylpropyl)azanide;tungsten?
The IUPAC name of methyl(2-methylpropyl)azanide;tungsten (CID 59806957) is methyl(2-methylpropyl)azanide;tungsten.
What is the SMILES notation for methyl(2-methylpropyl)azanide;tungsten?
The canonical SMILES for methyl(2-methylpropyl)azanide;tungsten is C[N-]CC(C)C.[W].
What is the InChIKey of methyl(2-methylpropyl)azanide;tungsten?
The InChIKey is DFFSSKHFDGOGLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N.W/c1-5(2)4-6-3;/h5H,4H2,1-3H3;/q-1;.
What are the key properties of methyl(2-methylpropyl)azanide;tungsten?
methyl(2-methylpropyl)azanide;tungsten has a molecular weight of 270.00 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(2-methylpropyl)azanide;tungsten is sourced from PubChem (CID 59806957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).