About CID 59806961
CID 59806961 (PubChem CID 59806961) has the molecular formula C5H5NO2
and a molecular weight of 111.10 g/mol.
Molecular Properties
| Compound Name | CID 59806961 |
| PubChem CID | 59806961 |
| Molecular Formula | C5H5NO2 |
| Molecular Weight | 111.10 g/mol |
| Exact Mass | 111.03 |
| IUPAC Name | — |
| SMILES | [CH]N1C(=O)CCC1=O |
| InChI | InChI=1S/C5H5NO2/c1-6-4(7)2-3-5(6)8/h1H,2-3H2 |
| InChIKey | QBXYYVAMGYEGRF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 59806961 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59806961?
The IUPAC name of CID 59806961 (CID 59806961) is not available.
What is the SMILES notation for CID 59806961?
The canonical SMILES for CID 59806961 is [CH]N1C(=O)CCC1=O.
What is the InChIKey of CID 59806961?
The InChIKey is QBXYYVAMGYEGRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2/c1-6-4(7)2-3-5(6)8/h1H,2-3H2.
What are the key properties of CID 59806961?
CID 59806961 has a molecular weight of 111.10 g/mol, XLogP of -0.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59806961 is sourced from PubChem (CID 59806961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).