C13H20FNO5 — CID 59807328
tert-butyl (3R,3aR,6S,6aS)-3-acetyloxy-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 59807328) has the molecular formula C13H20FNO5 and a molecular weight of 289.30 g/mol. Its IUPAC name is tert-butyl (3R,3aR,6S,6aS)-3-acetyloxy-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3R,3aR,6S,6aS)-3-acetyloxy-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 59807328 |
| Molecular Formula | C13H20FNO5 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | tert-butyl (3R,3aR,6S,6aS)-3-acetyloxy-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(=O)O[C@H]1CO[C@H]2[C@@H]1N(C(=O)OC(C)(C)C)C[C@@H]2F |
| InChI | InChI=1S/C13H20FNO5/c1-7(16)19-9-6-18-11-8(14)5-15(10(9)11)12(17)20-13(2,3)4/h8-11H,5-6H2,1-4H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | WDDWURYQCGAFTN-UKKRHICBSA-N |
| XLogP | 1.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |