C7H12FNO2 — CID 59807349
6-fluoro-4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-ol (PubChem CID 59807349) has the molecular formula C7H12FNO2 and a molecular weight of 161.18 g/mol. Its IUPAC name is 6-fluoro-4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-ol.
| Compound Name | 6-fluoro-4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-ol |
|---|---|
| PubChem CID | 59807349 |
| Molecular Formula | C7H12FNO2 |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | 6-fluoro-4-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-3-ol |
| SMILES | CN1CC(F)C2OCC(O)C21 |
| InChI | InChI=1S/C7H12FNO2/c1-9-2-4(8)7-6(9)5(10)3-11-7/h4-7,10H,2-3H2,1H3 |
| InChIKey | VDJFUJIDFOGOFO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |