About pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate
pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate (PubChem CID 59807627) has the molecular formula C26H27F3N2O3
and a molecular weight of 472.51 g/mol. Its IUPAC name is pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate.
Molecular Properties
| Compound Name | pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate |
| PubChem CID | 59807627 |
| Molecular Formula | C26H27F3N2O3 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(NC(=O)c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)cc1 |
| InChI | InChI=1S/C26H27F3N2O3/c1-4-5-8-15-34-25(33)19-11-13-20(14-12-19)30-24(32)21-16-17(2)31(18(21)3)23-10-7-6-9-22(23)26(27,28)29/h6-7,9-14,16H,4-5,8,15H2,1-3H3,(H,30,32) |
| InChIKey | ILCCIQWAZZCKOQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate?
The IUPAC name of pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate (CID 59807627) is pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate.
What is the SMILES notation for pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate?
The canonical SMILES for pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate is CCCCCOC(=O)c1ccc(NC(=O)c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)cc1.
What is the InChIKey of pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate?
The InChIKey is ILCCIQWAZZCKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27F3N2O3/c1-4-5-8-15-34-25(33)19-11-13-20(14-12-19)30-24(32)21-16-17(2)31(18(21)3)23-10-7-6-9-22(23)26(27,28)29/h6-7,9-14,16H,4-5,8,15H2,1-3H3,(H,30,32).
What are the key properties of pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate?
pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate has a molecular weight of 472.51 g/mol, XLogP of 6.71, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 4-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate is sourced from PubChem (CID 59807627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).