About 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide
5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide (PubChem CID 59807994) has the molecular formula C22H24N2O4S
and a molecular weight of 412.51 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide |
| PubChem CID | 59807994 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide |
| SMILES | COc1ccccc1-c1c(C)c(C(=O)N(C)c2ccc(S(C)(=O)=O)cc2)cn1C |
| InChI | InChI=1S/C22H24N2O4S/c1-15-19(14-23(2)21(15)18-8-6-7-9-20(18)28-4)22(25)24(3)16-10-12-17(13-11-16)29(5,26)27/h6-14H,1-5H3 |
| InChIKey | LBYDSERUAQEVBK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide?
The IUPAC name of 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide (CID 59807994) is 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide.
What is the SMILES notation for 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide?
The canonical SMILES for 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide is COc1ccccc1-c1c(C)c(C(=O)N(C)c2ccc(S(C)(=O)=O)cc2)cn1C.
What is the InChIKey of 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide?
The InChIKey is LBYDSERUAQEVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O4S/c1-15-19(14-23(2)21(15)18-8-6-7-9-20(18)28-4)22(25)24(3)16-10-12-17(13-11-16)29(5,26)27/h6-14H,1-5H3.
What are the key properties of 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide?
5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide has a molecular weight of 412.51 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxyphenyl)-N,1,4-trimethyl-N-(4-methylsulfonylphenyl)pyrrole-3-carboxamide is sourced from PubChem (CID 59807994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).