About 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine
2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine (PubChem CID 59808545) has the molecular formula C14H12N4O2S
and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 59808545 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine |
| SMILES | Cc1cc2c(cc1Sc1nc3c(N)nccc3[nH]1)OCO2 |
| InChI | InChI=1S/C14H12N4O2S/c1-7-4-9-10(20-6-19-9)5-11(7)21-14-17-8-2-3-16-13(15)12(8)18-14/h2-5H,6H2,1H3,(H2,15,16)(H,17,18) |
| InChIKey | SOVYTEOIFYUYII-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine (CID 59808545) is 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine is Cc1cc2c(cc1Sc1nc3c(N)nccc3[nH]1)OCO2.
What is the InChIKey of 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine?
The InChIKey is SOVYTEOIFYUYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2S/c1-7-4-9-10(20-6-19-9)5-11(7)21-14-17-8-2-3-16-13(15)12(8)18-14/h2-5H,6H2,1H3,(H2,15,16)(H,17,18).
What are the key properties of 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine?
2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine has a molecular weight of 300.34 g/mol, XLogP of 2.73, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]-1H-imidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 59808545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).