C24H32N6O2S — CID 59808754
1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-pyrrolidin-1-yl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine (PubChem CID 59808754) has the molecular formula C24H32N6O2S and a molecular weight of 468.63 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-pyrrolidin-1-yl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-pyrrolidin-1-yl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 59808754 |
| Molecular Formula | C24H32N6O2S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-pyrrolidin-1-yl-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine |
| SMILES | CC(C)(C)CNCCn1c(Sc2cc3c(cc2N2CCCC2)OCO3)nc2c(N)nccc21 |
| InChI | InChI=1S/C24H32N6O2S/c1-24(2,3)14-26-8-11-30-16-6-7-27-22(25)21(16)28-23(30)33-20-13-19-18(31-15-32-19)12-17(20)29-9-4-5-10-29/h6-7,12-13,26H,4-5,8-11,14-15H2,1-3H3,(H2,25,27) |
| InChIKey | AKHGZXHXLLVDRI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|