C29H33ClN4O4 — CID 59809684
N-[1-[4-(4-acetamidophenyl)phenyl]-2-morpholin-4-ylethyl]-2-(5-chloro-2-hydroxyanilino)-N-methylacetamide (PubChem CID 59809684) has the molecular formula C29H33ClN4O4 and a molecular weight of 537.06 g/mol. Its IUPAC name is N-[1-[4-(4-acetamidophenyl)phenyl]-2-morpholin-4-ylethyl]-2-(5-chloro-2-hydroxyanilino)-N-methylacetamide.
| Compound Name | N-[1-[4-(4-acetamidophenyl)phenyl]-2-morpholin-4-ylethyl]-2-(5-chloro-2-hydroxyanilino)-N-methylacetamide |
|---|---|
| PubChem CID | 59809684 |
| Molecular Formula | C29H33ClN4O4 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | N-[1-[4-(4-acetamidophenyl)phenyl]-2-morpholin-4-ylethyl]-2-(5-chloro-2-hydroxyanilino)-N-methylacetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc(C(CN3CCOCC3)N(C)C(=O)CNc3cc(Cl)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C29H33ClN4O4/c1-20(35)32-25-10-7-22(8-11-25)21-3-5-23(6-4-21)27(19-34-13-15-38-16-14-34)33(2)29(37)18-31-26-17-24(30)9-12-28(26)36/h3-12,17,27,31,36H,13-16,18-19H2,1-2H3,(H,32,35) |
| InChIKey | DSDIGPSSDKNMMX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|