C9H13N3O2 — CID 59810600
3,5,7-trimethyl-7,7a-dihydro-3aH-imidazo[4,5-c]pyridine-4,6-dione (PubChem CID 59810600) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3,5,7-trimethyl-7,7a-dihydro-3aH-imidazo[4,5-c]pyridine-4,6-dione.
| Compound Name | 3,5,7-trimethyl-7,7a-dihydro-3aH-imidazo[4,5-c]pyridine-4,6-dione |
|---|---|
| PubChem CID | 59810600 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3,5,7-trimethyl-7,7a-dihydro-3aH-imidazo[4,5-c]pyridine-4,6-dione |
| SMILES | CC1C(=O)N(C)C(=O)C2C1N=CN2C |
| InChI | InChI=1S/C9H13N3O2/c1-5-6-7(11(2)4-10-6)9(14)12(3)8(5)13/h4-7H,1-3H3 |
| InChIKey | WKCVNUAXFZVKBQ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|