C28H26O8 — CID 59811712
4-ethyl-7-(5-ethyl-4-formyl-1,6,7-trihydroxy-3-methylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methylnaphthalene-1-carbaldehyde (PubChem CID 59811712) has the molecular formula C28H26O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is 4-ethyl-7-(5-ethyl-4-formyl-1,6,7-trihydroxy-3-methylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methylnaphthalene-1-carbaldehyde.
| Compound Name | 4-ethyl-7-(5-ethyl-4-formyl-1,6,7-trihydroxy-3-methylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methylnaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 59811712 |
| Molecular Formula | C28H26O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 4-ethyl-7-(5-ethyl-4-formyl-1,6,7-trihydroxy-3-methylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methylnaphthalene-1-carbaldehyde |
| SMILES | CCc1c(O)c(O)c(C=O)c2c(O)c(-c3c(C)c(C=O)c4c(CC)c(O)c(O)cc4c3O)c(C)cc12 |
| InChI | InChI=1S/C28H26O8/c1-5-13-15-7-11(3)20(28(36)23(15)18(10-30)27(35)26(13)34)21-12(4)17(9-29)22-14(6-2)24(32)19(31)8-16(22)25(21)33/h7-10,31-36H,5-6H2,1-4H3 |
| InChIKey | JKVAKDVUPUYOOH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|