C14H23F3N2O4 — CID 59811750
3-(2-methoxyethoxy)-N-[4-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]propanamide (PubChem CID 59811750) has the molecular formula C14H23F3N2O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-N-[4-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]propanamide.
| Compound Name | 3-(2-methoxyethoxy)-N-[4-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 59811750 |
| Molecular Formula | C14H23F3N2O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-(2-methoxyethoxy)-N-[4-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]propanamide |
| SMILES | COCCOCCC(=O)NC1CCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H23F3N2O4/c1-22-8-9-23-7-6-12(20)18-10-2-4-11(5-3-10)19-13(21)14(15,16)17/h10-11H,2-9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | AZKRBWIOFBVGQH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|