About 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate
2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 59811767) has the molecular formula C18H29N3O8
and a molecular weight of 415.44 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate.
Molecular Properties
| Compound Name | 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate |
| PubChem CID | 59811767 |
| Molecular Formula | C18H29N3O8 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | COCCOC(=O)NCCOCCOCCNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H29N3O8/c1-26-11-14-29-18(25)20-7-10-28-13-12-27-9-6-19-15(22)3-2-8-21-16(23)4-5-17(21)24/h4-5H,2-3,6-14H2,1H3,(H,19,22)(H,20,25) |
| InChIKey | DFWVKTROBMYEAZ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate?
The IUPAC name of 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate (CID 59811767) is 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate.
What is the SMILES notation for 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate?
The canonical SMILES for 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate is COCCOC(=O)NCCOCCOCCNC(=O)CCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate?
The InChIKey is DFWVKTROBMYEAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O8/c1-26-11-14-29-18(25)20-7-10-28-13-12-27-9-6-19-15(22)3-2-8-21-16(23)4-5-17(21)24/h4-5H,2-3,6-14H2,1H3,(H,19,22)(H,20,25).
What are the key properties of 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate?
2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate has a molecular weight of 415.44 g/mol, XLogP of -0.79, 16 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl N-[2-[2-[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]ethoxy]ethoxy]ethyl]carbamate is sourced from PubChem (CID 59811767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).