About N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline
N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline (PubChem CID 59811898) has the molecular formula C19H22N4O
and a molecular weight of 322.41 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline |
| PubChem CID | 59811898 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline |
| SMILES | CN(C)c1ccc(-c2cnc3[nH]cc(N4CCOCC4)c3c2)cc1 |
| InChI | InChI=1S/C19H22N4O/c1-22(2)16-5-3-14(4-6-16)15-11-17-18(13-21-19(17)20-12-15)23-7-9-24-10-8-23/h3-6,11-13H,7-10H2,1-2H3,(H,20,21) |
| InChIKey | LNQQVOPBTOSAQC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline?
The IUPAC name of N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline (CID 59811898) is N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline.
What is the SMILES notation for N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline?
The canonical SMILES for N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline is CN(C)c1ccc(-c2cnc3[nH]cc(N4CCOCC4)c3c2)cc1.
What is the InChIKey of N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline?
The InChIKey is LNQQVOPBTOSAQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O/c1-22(2)16-5-3-14(4-6-16)15-11-17-18(13-21-19(17)20-12-15)23-7-9-24-10-8-23/h3-6,11-13H,7-10H2,1-2H3,(H,20,21).
What are the key properties of N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline?
N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline has a molecular weight of 322.41 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-(3-morpholin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline is sourced from PubChem (CID 59811898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).