About 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole
5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole (PubChem CID 59811938) has the molecular formula C10H6BrN3O
and a molecular weight of 264.08 g/mol. Its IUPAC name is 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole |
| PubChem CID | 59811938 |
| Molecular Formula | C10H6BrN3O |
| Molecular Weight | 264.08 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole |
| SMILES | Brc1cnc2[nH]cc(-c3cnco3)c2c1 |
| InChI | InChI=1S/C10H6BrN3O/c11-6-1-7-8(9-4-12-5-15-9)3-14-10(7)13-2-6/h1-5H,(H,13,14) |
| InChIKey | RLDDZKWJCWFAHH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.08 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole?
The IUPAC name of 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole (CID 59811938) is 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole.
What is the SMILES notation for 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole?
The canonical SMILES for 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole is Brc1cnc2[nH]cc(-c3cnco3)c2c1.
What is the InChIKey of 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole?
The InChIKey is RLDDZKWJCWFAHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrN3O/c11-6-1-7-8(9-4-12-5-15-9)3-14-10(7)13-2-6/h1-5H,(H,13,14).
What are the key properties of 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole?
5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole has a molecular weight of 264.08 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-oxazole is sourced from PubChem (CID 59811938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).