C32H24N2O4S — CID 59812209
3-(3-methoxyphenyl)-5-(2-phenoxyphenyl)-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine (PubChem CID 59812209) has the molecular formula C32H24N2O4S and a molecular weight of 532.62 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-5-(2-phenoxyphenyl)-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine.
| Compound Name | 3-(3-methoxyphenyl)-5-(2-phenoxyphenyl)-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59812209 |
| Molecular Formula | C32H24N2O4S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 3-(3-methoxyphenyl)-5-(2-phenoxyphenyl)-1-phenylsulfanylperoxypyrrolo[2,3-b]pyridine |
| SMILES | COc1cccc(-c2cn(OOSc3ccccc3)c3ncc(-c4ccccc4Oc4ccccc4)cc23)c1 |
| InChI | InChI=1S/C32H24N2O4S/c1-35-26-14-10-11-23(19-26)30-22-34(37-38-39-27-15-6-3-7-16-27)32-29(30)20-24(21-33-32)28-17-8-9-18-31(28)36-25-12-4-2-5-13-25/h2-22H,1H3 |
| InChIKey | NFCCTAKZSXVPEU-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|