C25H26N2O11P2-2 — CID 59812647
[[(2R,4S,5R)-3,4-dihydroxy-5-(2-oxo-6-phenyl-1,7a-dihydrofuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-(3,4-dimethylphenyl)phosphinate (PubChem CID 59812647) has the molecular formula C25H26N2O11P2-2 and a molecular weight of 592.43 g/mol. Its IUPAC name is [[(2R,4S,5R)-3,4-dihydroxy-5-(2-oxo-6-phenyl-1,7a-dihydrofuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-(3,4-dimethylphenyl)phosphinate.
| Compound Name | [[(2R,4S,5R)-3,4-dihydroxy-5-(2-oxo-6-phenyl-1,7a-dihydrofuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-(3,4-dimethylphenyl)phosphinate |
|---|---|
| PubChem CID | 59812647 |
| Molecular Formula | C25H26N2O11P2-2 |
| Molecular Weight | 592.43 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | [[(2R,4S,5R)-3,4-dihydroxy-5-(2-oxo-6-phenyl-1,7a-dihydrofuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methoxy-oxidophosphoryl]oxy-(3,4-dimethylphenyl)phosphinate |
| SMILES | Cc1ccc(P(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](N3C=C4C=C(c5ccccc5)OC4NC3=O)[C@@H](O)C2O)cc1C |
| InChI | InChI=1S/C25H28N2O11P2/c1-14-8-9-18(10-15(14)2)39(31,32)38-40(33,34)35-13-20-21(28)22(29)24(37-20)27-12-17-11-19(16-6-4-3-5-7-16)36-23(17)26-25(27)30/h3-12,20-24,28-29H,13H2,1-2H3,(H,26,30)(H,31,32)(H,33,34)/p-2/t20-,21?,22+,23?,24-/m1/s1 |
| InChIKey | MSMNXWREIUZYRX-PUCCQLNPSA-L |
| XLogP | 0.74 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|