C18H21F2N3O3Si — CID 59812975
6-(2,4-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)-4H-pyrazolo[4,5-b]pyridin-5-one (PubChem CID 59812975) has the molecular formula C18H21F2N3O3Si and a molecular weight of 393.47 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)-4H-pyrazolo[4,5-b]pyridin-5-one.
| Compound Name | 6-(2,4-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)-4H-pyrazolo[4,5-b]pyridin-5-one |
|---|---|
| PubChem CID | 59812975 |
| Molecular Formula | C18H21F2N3O3Si |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)-4H-pyrazolo[4,5-b]pyridin-5-one |
| SMILES | C[Si](C)(C)CCOCn1ncc2[nH]c(=O)c(Oc3ccc(F)cc3F)cc21 |
| InChI | InChI=1S/C18H21F2N3O3Si/c1-27(2,3)7-6-25-11-23-15-9-17(18(24)22-14(15)10-21-23)26-16-5-4-12(19)8-13(16)20/h4-5,8-10H,6-7,11H2,1-3H3,(H,22,24) |
| InChIKey | FUONRFVCXZZRHA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|