About 8-ethenoxytricyclo[5.2.1.02,6]decane
8-ethenoxytricyclo[5.2.1.02,6]decane (PubChem CID 59813138) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 8-ethenoxytricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 8-ethenoxytricyclo[5.2.1.02,6]decane |
| PubChem CID | 59813138 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 8-ethenoxytricyclo[5.2.1.02,6]decane |
| SMILES | C=COC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C12H18O/c1-2-13-12-7-8-6-11(12)10-5-3-4-9(8)10/h2,8-12H,1,3-7H2 |
| InChIKey | PKTORKCIXKNVFR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 8-ethenoxytricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethenoxytricyclo[5.2.1.02,6]decane?
The IUPAC name of 8-ethenoxytricyclo[5.2.1.02,6]decane (CID 59813138) is 8-ethenoxytricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 8-ethenoxytricyclo[5.2.1.02,6]decane?
The canonical SMILES for 8-ethenoxytricyclo[5.2.1.02,6]decane is C=COC1CC2CC1C1CCCC21.
What is the InChIKey of 8-ethenoxytricyclo[5.2.1.02,6]decane?
The InChIKey is PKTORKCIXKNVFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-2-13-12-7-8-6-11(12)10-5-3-4-9(8)10/h2,8-12H,1,3-7H2.
What are the key properties of 8-ethenoxytricyclo[5.2.1.02,6]decane?
8-ethenoxytricyclo[5.2.1.02,6]decane has a molecular weight of 178.27 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethenoxytricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 59813138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).