C17H4O7S — CID 59814102
7,17-dioxa-2-thiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,12,16,18-pentone (PubChem CID 59814102) has the molecular formula C17H4O7S and a molecular weight of 352.28 g/mol. Its IUPAC name is 7,17-dioxa-2-thiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,12,16,18-pentone.
| Compound Name | 7,17-dioxa-2-thiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,12,16,18-pentone |
|---|---|
| PubChem CID | 59814102 |
| Molecular Formula | C17H4O7S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 7,17-dioxa-2-thiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,12,16,18-pentone |
| SMILES | O=c1c2cc3c(=O)oc(=O)c3cc2sc2cc3c(=O)oc(=O)c3cc12 |
| InChI | InChI=1S/C17H4O7S/c18-13-9-1-5-7(16(21)23-14(5)19)3-11(9)25-12-4-8-6(2-10(12)13)15(20)24-17(8)22/h1-4H |
| InChIKey | HGUPHTYQJALKCJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 111.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|