C12H16F4O7S — CID 59814208
[2-(1-methylcyclohexyl)oxy-2-oxoethyl] 2,3,3,3-tetrafluoro-2-(trioxidanylsulfanyl)propanoate (PubChem CID 59814208) has the molecular formula C12H16F4O7S and a molecular weight of 380.31 g/mol. Its IUPAC name is [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 2,3,3,3-tetrafluoro-2-(trioxidanylsulfanyl)propanoate.
| Compound Name | [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 2,3,3,3-tetrafluoro-2-(trioxidanylsulfanyl)propanoate |
|---|---|
| PubChem CID | 59814208 |
| Molecular Formula | C12H16F4O7S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 2,3,3,3-tetrafluoro-2-(trioxidanylsulfanyl)propanoate |
| SMILES | CC1(OC(=O)COC(=O)C(F)(SOOO)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C12H16F4O7S/c1-10(5-3-2-4-6-10)21-8(17)7-20-9(18)11(13,12(14,15)16)24-23-22-19/h19H,2-7H2,1H3 |
| InChIKey | GQZKCBVBCKMGMN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|