About 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine
10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine (PubChem CID 59814689) has the molecular formula C25H25N3O2
and a molecular weight of 399.49 g/mol. Its IUPAC name is 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine.
Molecular Properties
| Compound Name | 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine |
| PubChem CID | 59814689 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine |
| SMILES | COc1cccc2c1Oc1cc(-c3ccncc3)ccc1N2C1C[C@H]2CC[C@@H](C1)N2 |
| InChI | InChI=1S/C25H25N3O2/c1-29-23-4-2-3-22-25(23)30-24-13-17(16-9-11-26-12-10-16)5-8-21(24)28(22)20-14-18-6-7-19(15-20)27-18/h2-5,8-13,18-20,27H,6-7,14-15H2,1H3/t18-,19+,20? |
| InChIKey | IBFCDNBFVWLLSP-YOFSQIOKSA-N |
| XLogP | 5.28 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine?
The IUPAC name of 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine (CID 59814689) is 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine.
What is the SMILES notation for 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine?
The canonical SMILES for 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine is COc1cccc2c1Oc1cc(-c3ccncc3)ccc1N2C1C[C@H]2CC[C@@H](C1)N2.
What is the InChIKey of 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine?
The InChIKey is IBFCDNBFVWLLSP-YOFSQIOKSA-N. The full InChI is InChI=1S/C25H25N3O2/c1-29-23-4-2-3-22-25(23)30-24-13-17(16-9-11-26-12-10-16)5-8-21(24)28(22)20-14-18-6-7-19(15-20)27-18/h2-5,8-13,18-20,27H,6-7,14-15H2,1H3/t18-,19+,20?.
What are the key properties of 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine?
10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine has a molecular weight of 399.49 g/mol, XLogP of 5.28, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]-6-methoxy-3-pyridin-4-ylphenoxazine is sourced from PubChem (CID 59814689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).