C24H17F4NO5S2 — CID 59814857
7-[[5-[3-(1,3-dioxolan-2-yl)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-1,3-thiazol-2-yl]sulfanyl]-4-(4-fluorophenyl)chromen-2-one (PubChem CID 59814857) has the molecular formula C24H17F4NO5S2 and a molecular weight of 539.53 g/mol. Its IUPAC name is 7-[[5-[3-(1,3-dioxolan-2-yl)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-1,3-thiazol-2-yl]sulfanyl]-4-(4-fluorophenyl)chromen-2-one.
| Compound Name | 7-[[5-[3-(1,3-dioxolan-2-yl)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-1,3-thiazol-2-yl]sulfanyl]-4-(4-fluorophenyl)chromen-2-one |
|---|---|
| PubChem CID | 59814857 |
| Molecular Formula | C24H17F4NO5S2 |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 7-[[5-[3-(1,3-dioxolan-2-yl)-1,1,1-trifluoro-2-hydroxypropan-2-yl]-1,3-thiazol-2-yl]sulfanyl]-4-(4-fluorophenyl)chromen-2-one |
| SMILES | O=c1cc(-c2ccc(F)cc2)c2ccc(Sc3ncc(C(O)(CC4OCCO4)C(F)(F)F)s3)cc2o1 |
| InChI | InChI=1S/C24H17F4NO5S2/c25-14-3-1-13(2-4-14)17-10-20(30)34-18-9-15(5-6-16(17)18)35-22-29-12-19(36-22)23(31,24(26,27)28)11-21-32-7-8-33-21/h1-6,9-10,12,21,31H,7-8,11H2 |
| InChIKey | JNXSFKFXKYTUCA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|