About (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine
(Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine (PubChem CID 59815251) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine.
Analyze (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine?
The IUPAC name of (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine (CID 59815251) is (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine.
What is the SMILES notation for (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine?
The canonical SMILES for (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine is CN(/C=C\N(C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine?
The InChIKey is KDAJMXFZJFRJDF-KTKRTIGZSA-N. The full InChI is InChI=1S/C12H26N2/c1-11(2,3)13(7)9-10-14(8)12(4,5)6/h9-10H,1-8H3/b10-9-.
What are the key properties of (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine?
(Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N'-ditert-butyl-N,N'-dimethylethene-1,2-diamine is sourced from PubChem (CID 59815251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).