About 4-methyl-2,3-dimethylidene-1,4-oxazine
4-methyl-2,3-dimethylidene-1,4-oxazine (PubChem CID 59815581) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 4-methyl-2,3-dimethylidene-1,4-oxazine.
Molecular Properties
| Compound Name | 4-methyl-2,3-dimethylidene-1,4-oxazine |
| PubChem CID | 59815581 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 4-methyl-2,3-dimethylidene-1,4-oxazine |
| SMILES | C=C1OC=CN(C)C1=C |
| InChI | InChI=1S/C7H9NO/c1-6-7(2)9-5-4-8(6)3/h4-5H,1-2H2,3H3 |
| InChIKey | RETODEYARIYPGA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2,3-dimethylidene-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dimethylidene-1,4-oxazine?
The IUPAC name of 4-methyl-2,3-dimethylidene-1,4-oxazine (CID 59815581) is 4-methyl-2,3-dimethylidene-1,4-oxazine.
What is the SMILES notation for 4-methyl-2,3-dimethylidene-1,4-oxazine?
The canonical SMILES for 4-methyl-2,3-dimethylidene-1,4-oxazine is C=C1OC=CN(C)C1=C.
What is the InChIKey of 4-methyl-2,3-dimethylidene-1,4-oxazine?
The InChIKey is RETODEYARIYPGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-6-7(2)9-5-4-8(6)3/h4-5H,1-2H2,3H3.
What are the key properties of 4-methyl-2,3-dimethylidene-1,4-oxazine?
4-methyl-2,3-dimethylidene-1,4-oxazine has a molecular weight of 123.15 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dimethylidene-1,4-oxazine is sourced from PubChem (CID 59815581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).