About 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione
4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione (PubChem CID 59815880) has the molecular formula C5H3NO3S2
and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione |
| PubChem CID | 59815880 |
| Molecular Formula | C5H3NO3S2 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 188.96 |
| IUPAC Name | 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione |
| SMILES | C=CC(=O)n1c(=O)ssc1=O |
| InChI | InChI=1S/C5H3NO3S2/c1-2-3(7)6-4(8)10-11-5(6)9/h2H,1H2 |
| InChIKey | LROKMZZNZDHSRC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione?
The IUPAC name of 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione (CID 59815880) is 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione.
What is the SMILES notation for 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione?
The canonical SMILES for 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione is C=CC(=O)n1c(=O)ssc1=O.
What is the InChIKey of 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione?
The InChIKey is LROKMZZNZDHSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3NO3S2/c1-2-3(7)6-4(8)10-11-5(6)9/h2H,1H2.
What are the key properties of 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione?
4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione has a molecular weight of 189.22 g/mol, XLogP of 0.16, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enoyl-1,2,4-dithiazolidine-3,5-dione is sourced from PubChem (CID 59815880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).