C8H10F6 — CID 59816202
2-ethyl-1,1,3,3,4,4-hexafluoro-2-methylcyclopentane (PubChem CID 59816202) has the molecular formula C8H10F6 and a molecular weight of 220.16 g/mol. Its IUPAC name is 2-ethyl-1,1,3,3,4,4-hexafluoro-2-methylcyclopentane.
| Compound Name | 2-ethyl-1,1,3,3,4,4-hexafluoro-2-methylcyclopentane |
|---|---|
| PubChem CID | 59816202 |
| Molecular Formula | C8H10F6 |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-ethyl-1,1,3,3,4,4-hexafluoro-2-methylcyclopentane |
| SMILES | CCC1(C)C(F)(F)CC(F)(F)C1(F)F |
| InChI | InChI=1S/C8H10F6/c1-3-5(2)6(9,10)4-7(11,12)8(5,13)14/h3-4H2,1-2H3 |
| InChIKey | AZBGLTJWQWKZIB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|