C71H76O — CID 59816802
[3,5-bis[(E)-2-[3,5-bis[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]ethenyl]phenyl]methanol (PubChem CID 59816802) has the molecular formula C71H76O and a molecular weight of 945.39 g/mol. Its IUPAC name is [3,5-bis[(E)-2-[3,5-bis[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]ethenyl]phenyl]methanol.
| Compound Name | [3,5-bis[(E)-2-[3,5-bis[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 59816802 |
| Molecular Formula | C71H76O |
| Molecular Weight | 945.39 g/mol |
| Exact Mass | 944.59 |
| IUPAC Name | [3,5-bis[(E)-2-[3,5-bis[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]ethenyl]phenyl]methanol |
| SMILES | CC(C)(C)c1ccc(/C=C/c2cc(/C=C/c3ccc(C(C)(C)C)cc3)cc(/C=C/c3cc(/C=C/c4cc(/C=C/c5ccc(C(C)(C)C)cc5)cc(/C=C/c5ccc(C(C)(C)C)cc5)c4)cc(CO)c3)c2)cc1 |
| InChI | InChI=1S/C71H76O/c1-68(2,3)64-33-25-51(26-34-64)13-17-55-41-56(18-14-52-27-35-65(36-28-52)69(4,5)6)44-59(43-55)21-23-61-47-62(49-63(48-61)50-72)24-22-60-45-57(19-15-53-29-37-66(38-30-53)70(7,8)9)42-58(46-60)20-16-54-31-39-67(40-32-54)71(10,11)12/h13-49,72H,50H2,1-12H3/b17-13+,18-14+,19-15+,20-16+,23-21+,24-22+ |
| InChIKey | FNVWCERXEVJISQ-KERSXIQOSA-N |
| XLogP | 19.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.39 |
| LogP ≤ 5 | 19.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|