C23H22N2Pt — CID 59816879
N-ethenyl-1-[3-[(5Z)-4-ethenyl-2-methylidene-5-(methylideneamino)octa-3,5,7-trienyl]benzene-2-id-1-yl]prop-2-en-1-imine;platinum(2+) (PubChem CID 59816879) has the molecular formula C23H22N2Pt and a molecular weight of 521.52 g/mol. Its IUPAC name is N-ethenyl-1-[3-[(5Z)-4-ethenyl-2-methylidene-5-(methylideneamino)octa-3,5,7-trienyl]benzene-2-id-1-yl]prop-2-en-1-imine;platinum(2+).
| Compound Name | N-ethenyl-1-[3-[(5Z)-4-ethenyl-2-methylidene-5-(methylideneamino)octa-3,5,7-trienyl]benzene-2-id-1-yl]prop-2-en-1-imine;platinum(2+) |
|---|---|
| PubChem CID | 59816879 |
| Molecular Formula | C23H22N2Pt |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | N-ethenyl-1-[3-[(5Z)-4-ethenyl-2-methylidene-5-(methylideneamino)octa-3,5,7-trienyl]benzene-2-id-1-yl]prop-2-en-1-imine;platinum(2+) |
| SMILES | C=C/C=C(\N=C)C(=[C-]C(=C)Cc1[c-]c(/C(C=C)=N/C=C)ccc1)C=C.[Pt+2] |
| InChI | InChI=1S/C23H22N2.Pt/c1-7-12-23(24-6)20(8-2)16-18(5)15-19-13-11-14-21(17-19)22(9-3)25-10-4;/h7-14H,1-6,15H2;/q-2;+2/b23-12-,25-22+; |
| InChIKey | MWHIOFYRGRNZSH-PGAPGTKUSA-N |
| XLogP | 5.39 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|