C43H26N4O2Pt — CID 59816888
1-(3H-dibenzofuran-3-id-2-yl)-3-[[1-(3H-dibenzofuran-3-id-2-yl)pyrazol-3-yl]-diphenylmethyl]pyrazole;platinum(2+) (PubChem CID 59816888) has the molecular formula C43H26N4O2Pt and a molecular weight of 825.79 g/mol. Its IUPAC name is 1-(3H-dibenzofuran-3-id-2-yl)-3-[[1-(3H-dibenzofuran-3-id-2-yl)pyrazol-3-yl]-diphenylmethyl]pyrazole;platinum(2+).
| Compound Name | 1-(3H-dibenzofuran-3-id-2-yl)-3-[[1-(3H-dibenzofuran-3-id-2-yl)pyrazol-3-yl]-diphenylmethyl]pyrazole;platinum(2+) |
|---|---|
| PubChem CID | 59816888 |
| Molecular Formula | C43H26N4O2Pt |
| Molecular Weight | 825.79 g/mol |
| Exact Mass | 825.17 |
| IUPAC Name | 1-(3H-dibenzofuran-3-id-2-yl)-3-[[1-(3H-dibenzofuran-3-id-2-yl)pyrazol-3-yl]-diphenylmethyl]pyrazole;platinum(2+) |
| SMILES | [Pt+2].[c-]1cc2oc3ccccc3c2cc1-n1ccc(C(c2ccccc2)(c2ccccc2)c2ccn(-c3[c-]cc4oc5ccccc5c4c3)n2)n1 |
| InChI | InChI=1S/C43H26N4O2.Pt/c1-3-11-29(12-4-1)43(30-13-5-2-6-14-30,41-23-25-46(44-41)31-19-21-39-35(27-31)33-15-7-9-17-37(33)48-39)42-24-26-47(45-42)32-20-22-40-36(28-32)34-16-8-10-18-38(34)49-40;/h1-18,21-28H;/q-2;+2 |
| InChIKey | UURJIQKAURIPCX-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.79 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|