C33H22N4O2Pt — CID 59816897
1-(3H-dibenzofuran-3-id-2-yl)-3-[2-[1-(3H-dibenzofuran-3-id-2-yl)pyrazol-3-yl]propan-2-yl]pyrazole;platinum(2+) (PubChem CID 59816897) has the molecular formula C33H22N4O2Pt and a molecular weight of 701.64 g/mol. Its IUPAC name is 1-(3H-dibenzofuran-3-id-2-yl)-3-[2-[1-(3H-dibenzofuran-3-id-2-yl)pyrazol-3-yl]propan-2-yl]pyrazole;platinum(2+).
| Compound Name | 1-(3H-dibenzofuran-3-id-2-yl)-3-[2-[1-(3H-dibenzofuran-3-id-2-yl)pyrazol-3-yl]propan-2-yl]pyrazole;platinum(2+) |
|---|---|
| PubChem CID | 59816897 |
| Molecular Formula | C33H22N4O2Pt |
| Molecular Weight | 701.64 g/mol |
| Exact Mass | 701.14 |
| IUPAC Name | 1-(3H-dibenzofuran-3-id-2-yl)-3-[2-[1-(3H-dibenzofuran-3-id-2-yl)pyrazol-3-yl]propan-2-yl]pyrazole;platinum(2+) |
| SMILES | CC(C)(c1ccn(-c2[c-]cc3oc4ccccc4c3c2)n1)c1ccn(-c2[c-]cc3oc4ccccc4c3c2)n1.[Pt+2] |
| InChI | InChI=1S/C33H22N4O2.Pt/c1-33(2,31-15-17-36(34-31)21-11-13-29-25(19-21)23-7-3-5-9-27(23)38-29)32-16-18-37(35-32)22-12-14-30-26(20-22)24-8-4-6-10-28(24)39-30;/h3-10,13-20H,1-2H3;/q-2;+2 |
| InChIKey | FSPULILTNUDSCB-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.64 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|