About 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene
2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene (PubChem CID 59816976) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene.
Molecular Properties
| Compound Name | 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene |
| PubChem CID | 59816976 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene |
| SMILES | C=C(C)C(=C)OCC(COC)OC |
| InChI | InChI=1S/C10H18O3/c1-8(2)9(3)13-7-10(12-5)6-11-4/h10H,1,3,6-7H2,2,4-5H3 |
| InChIKey | YZSDWTJXKGGBKQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene?
The IUPAC name of 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene (CID 59816976) is 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene.
What is the SMILES notation for 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene?
The canonical SMILES for 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene is C=C(C)C(=C)OCC(COC)OC.
What is the InChIKey of 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene?
The InChIKey is YZSDWTJXKGGBKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-8(2)9(3)13-7-10(12-5)6-11-4/h10H,1,3,6-7H2,2,4-5H3.
What are the key properties of 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene?
2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene has a molecular weight of 186.25 g/mol, XLogP of 1.75, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethoxypropoxy)-3-methylbuta-1,3-diene is sourced from PubChem (CID 59816976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).