About CID 59817205
CID 59817205 (PubChem CID 59817205) has the molecular formula C38H46O3Te-
and a molecular weight of 678.38 g/mol.
Molecular Properties
| Compound Name | CID 59817205 |
| PubChem CID | 59817205 |
| Molecular Formula | C38H46O3Te- |
| Molecular Weight | 678.38 g/mol |
| Exact Mass | 680.25 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=CC(=C(C2=C([O-])C(=CC3=CC(C(C)(C)C)=[Te]C(C(C)(C)C)=C3)C2=O)c2ccccc2)C=C(C(C)(C)C)O1 |
| InChI | InChI=1S/C38H47O3Te/c1-35(2,3)27-21-25(22-28(41-27)36(4,5)6)31(24-16-14-13-15-17-24)32-33(39)26(34(32)40)18-23-19-29(37(7,8)9)42-30(20-23)38(10,11)12/h13-22,39H,1-12H3/p-1 |
| InChIKey | QVYKVIYIBHRCJI-UHFFFAOYSA-M |
| XLogP | 8.25 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 678.38 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59817205 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59817205?
The IUPAC name of CID 59817205 (CID 59817205) is not available.
What is the SMILES notation for CID 59817205?
The canonical SMILES for CID 59817205 is CC(C)(C)C1=CC(=C(C2=C([O-])C(=CC3=CC(C(C)(C)C)=[Te]C(C(C)(C)C)=C3)C2=O)c2ccccc2)C=C(C(C)(C)C)O1.
What is the InChIKey of CID 59817205?
The InChIKey is QVYKVIYIBHRCJI-UHFFFAOYSA-M. The full InChI is InChI=1S/C38H47O3Te/c1-35(2,3)27-21-25(22-28(41-27)36(4,5)6)31(24-16-14-13-15-17-24)32-33(39)26(34(32)40)18-23-19-29(37(7,8)9)42-30(20-23)38(10,11)12/h13-22,39H,1-12H3/p-1.
What are the key properties of CID 59817205?
CID 59817205 has a molecular weight of 678.38 g/mol, XLogP of 8.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59817205 is sourced from PubChem (CID 59817205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).