About 6-phenylbenzo[b][1,4]benzothiazepine
6-phenylbenzo[b][1,4]benzothiazepine (PubChem CID 59817249) has the molecular formula C19H13NS
and a molecular weight of 287.39 g/mol. Its IUPAC name is 6-phenylbenzo[b][1,4]benzothiazepine.
Molecular Properties
| Compound Name | 6-phenylbenzo[b][1,4]benzothiazepine |
| PubChem CID | 59817249 |
| Molecular Formula | C19H13NS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 6-phenylbenzo[b][1,4]benzothiazepine |
| SMILES | c1ccc(C2=Nc3ccccc3Sc3ccccc32)cc1 |
| InChI | InChI=1S/C19H13NS/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)21-18-13-7-5-11-16(18)20-19/h1-13H |
| InChIKey | HFJAEPBBOUBCGX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenylbenzo[b][1,4]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylbenzo[b][1,4]benzothiazepine?
The IUPAC name of 6-phenylbenzo[b][1,4]benzothiazepine (CID 59817249) is 6-phenylbenzo[b][1,4]benzothiazepine.
What is the SMILES notation for 6-phenylbenzo[b][1,4]benzothiazepine?
The canonical SMILES for 6-phenylbenzo[b][1,4]benzothiazepine is c1ccc(C2=Nc3ccccc3Sc3ccccc32)cc1.
What is the InChIKey of 6-phenylbenzo[b][1,4]benzothiazepine?
The InChIKey is HFJAEPBBOUBCGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NS/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)21-18-13-7-5-11-16(18)20-19/h1-13H.
What are the key properties of 6-phenylbenzo[b][1,4]benzothiazepine?
6-phenylbenzo[b][1,4]benzothiazepine has a molecular weight of 287.39 g/mol, XLogP of 5.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylbenzo[b][1,4]benzothiazepine is sourced from PubChem (CID 59817249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).