About N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide
N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide (PubChem CID 59817353) has the molecular formula C9H20N4O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide |
| PubChem CID | 59817353 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide |
| SMILES | CNNCC(NC(=O)C(C)(C)C)C(N)=O |
| InChI | InChI=1S/C9H20N4O2/c1-9(2,3)8(15)13-6(7(10)14)5-12-11-4/h6,11-12H,5H2,1-4H3,(H2,10,14)(H,13,15) |
| InChIKey | GYCFPJFHKQAESS-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide?
The IUPAC name of N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide (CID 59817353) is N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide is CNNCC(NC(=O)C(C)(C)C)C(N)=O.
What is the InChIKey of N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide?
The InChIKey is GYCFPJFHKQAESS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N4O2/c1-9(2,3)8(15)13-6(7(10)14)5-12-11-4/h6,11-12H,5H2,1-4H3,(H2,10,14)(H,13,15).
What are the key properties of N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide?
N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide has a molecular weight of 216.28 g/mol, XLogP of -1.27, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-amino-3-(2-methylhydrazinyl)-1-oxopropan-2-yl]-2,2-dimethylpropanamide is sourced from PubChem (CID 59817353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).