About ethyl 4-cyclopentyl-2,4-dioxobutanoate
ethyl 4-cyclopentyl-2,4-dioxobutanoate (PubChem CID 59817645) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is ethyl 4-cyclopentyl-2,4-dioxobutanoate.
Molecular Properties
| Compound Name | ethyl 4-cyclopentyl-2,4-dioxobutanoate |
| PubChem CID | 59817645 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | ethyl 4-cyclopentyl-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)C1CCCC1 |
| InChI | InChI=1S/C11H16O4/c1-2-15-11(14)10(13)7-9(12)8-5-3-4-6-8/h8H,2-7H2,1H3 |
| InChIKey | AOYNIBGVQSISLX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-cyclopentyl-2,4-dioxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-cyclopentyl-2,4-dioxobutanoate?
The IUPAC name of ethyl 4-cyclopentyl-2,4-dioxobutanoate (CID 59817645) is ethyl 4-cyclopentyl-2,4-dioxobutanoate.
What is the SMILES notation for ethyl 4-cyclopentyl-2,4-dioxobutanoate?
The canonical SMILES for ethyl 4-cyclopentyl-2,4-dioxobutanoate is CCOC(=O)C(=O)CC(=O)C1CCCC1.
What is the InChIKey of ethyl 4-cyclopentyl-2,4-dioxobutanoate?
The InChIKey is AOYNIBGVQSISLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-2-15-11(14)10(13)7-9(12)8-5-3-4-6-8/h8H,2-7H2,1H3.
What are the key properties of ethyl 4-cyclopentyl-2,4-dioxobutanoate?
ethyl 4-cyclopentyl-2,4-dioxobutanoate has a molecular weight of 212.24 g/mol, XLogP of 1.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-cyclopentyl-2,4-dioxobutanoate is sourced from PubChem (CID 59817645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).