About 2-(difluoromethyl)-1,5-dimethylpyridin-4-one
2-(difluoromethyl)-1,5-dimethylpyridin-4-one (PubChem CID 59818294) has the molecular formula C8H9F2NO
and a molecular weight of 173.16 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,5-dimethylpyridin-4-one.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1,5-dimethylpyridin-4-one |
| PubChem CID | 59818294 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-(difluoromethyl)-1,5-dimethylpyridin-4-one |
| SMILES | Cc1cn(C)c(C(F)F)cc1=O |
| InChI | InChI=1S/C8H9F2NO/c1-5-4-11(2)6(8(9)10)3-7(5)12/h3-4,8H,1-2H3 |
| InChIKey | WFLYBPROOQXMAI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(difluoromethyl)-1,5-dimethylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1,5-dimethylpyridin-4-one?
The IUPAC name of 2-(difluoromethyl)-1,5-dimethylpyridin-4-one (CID 59818294) is 2-(difluoromethyl)-1,5-dimethylpyridin-4-one.
What is the SMILES notation for 2-(difluoromethyl)-1,5-dimethylpyridin-4-one?
The canonical SMILES for 2-(difluoromethyl)-1,5-dimethylpyridin-4-one is Cc1cn(C)c(C(F)F)cc1=O.
What is the InChIKey of 2-(difluoromethyl)-1,5-dimethylpyridin-4-one?
The InChIKey is WFLYBPROOQXMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO/c1-5-4-11(2)6(8(9)10)3-7(5)12/h3-4,8H,1-2H3.
What are the key properties of 2-(difluoromethyl)-1,5-dimethylpyridin-4-one?
2-(difluoromethyl)-1,5-dimethylpyridin-4-one has a molecular weight of 173.16 g/mol, XLogP of 1.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1,5-dimethylpyridin-4-one is sourced from PubChem (CID 59818294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).